C34H31F3O10 — CID 160623943
[2,3,5-trifluoro-4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoyl]oxyphenyl] 4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoate (PubChem CID 160623943) has the molecular formula C34H31F3O10 and a molecular weight of 656.61 g/mol. Its IUPAC name is [2,3,5-trifluoro-4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoyl]oxyphenyl] 4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoate.
| Compound Name | [2,3,5-trifluoro-4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoyl]oxyphenyl] 4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoate |
|---|---|
| PubChem CID | 160623943 |
| Molecular Formula | C34H31F3O10 |
| Molecular Weight | 656.61 g/mol |
| Exact Mass | 656.19 |
| IUPAC Name | [2,3,5-trifluoro-4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoyl]oxyphenyl] 4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc(C(=O)Oc2cc(F)c(OC(=O)c3ccc(OCCCOC(=O)C(=C)C)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C34H31F3O10/c1-20(2)31(38)44-17-5-15-42-24-11-7-22(8-12-24)33(40)46-27-19-26(35)30(29(37)28(27)36)47-34(41)23-9-13-25(14-10-23)43-16-6-18-45-32(39)21(3)4/h7-14,19H,1,3,5-6,15-18H2,2,4H3 |
| InChIKey | VBQZETJKKKVAKD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.61 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|