C36H37FO10 — CID 161330088
[3-fluoro-4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl] 4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoate (PubChem CID 161330088) has the molecular formula C36H37FO10 and a molecular weight of 648.68 g/mol. Its IUPAC name is [3-fluoro-4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl] 4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoate.
| Compound Name | [3-fluoro-4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl] 4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoate |
|---|---|
| PubChem CID | 161330088 |
| Molecular Formula | C36H37FO10 |
| Molecular Weight | 648.68 g/mol |
| Exact Mass | 648.24 |
| IUPAC Name | [3-fluoro-4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl] 4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCOC(=O)C(=C)C)cc3)cc2F)cc1 |
| InChI | InChI=1S/C36H37FO10/c1-4-33(38)44-21-8-6-5-7-20-42-28-16-12-27(13-17-28)36(41)47-32-19-18-30(24-31(32)37)46-35(40)26-10-14-29(15-11-26)43-22-9-23-45-34(39)25(2)3/h4,10-19,24H,1-2,5-9,20-23H2,3H3 |
| InChIKey | GEGWEVVPZAGZPW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.68 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|