C39H41FO11 — CID 134529051
[2-fluoro-4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenyl] 3,4-bis[3-(2-methylprop-2-enoyloxy)propoxy]benzoate (PubChem CID 134529051) has the molecular formula C39H41FO11 and a molecular weight of 704.74 g/mol. Its IUPAC name is [2-fluoro-4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenyl] 3,4-bis[3-(2-methylprop-2-enoyloxy)propoxy]benzoate.
| Compound Name | [2-fluoro-4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenyl] 3,4-bis[3-(2-methylprop-2-enoyloxy)propoxy]benzoate |
|---|---|
| PubChem CID | 134529051 |
| Molecular Formula | C39H41FO11 |
| Molecular Weight | 704.74 g/mol |
| Exact Mass | 704.26 |
| IUPAC Name | [2-fluoro-4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenyl] 3,4-bis[3-(2-methylprop-2-enoyloxy)propoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OCCOC(=O)C(=C)C)cc3)cc2F)cc1OCCCOC(=O)C(=C)C |
| InChI | InChI=1S/C39H41FO11/c1-25(2)36(41)48-19-7-17-46-34-16-12-30(24-35(34)47-18-8-20-49-37(42)26(3)4)39(44)51-33-15-11-29(23-32(33)40)28-9-13-31(14-10-28)45-21-22-50-38(43)27(5)6/h9-16,23-24H,1,3,5,7-8,17-22H2,2,4,6H3 |
| InChIKey | FBZKMMSRPVAHIF-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.74 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|