C24H18F2O5 — CID 59360270
[2-fluoro-4-(4-fluorophenyl)phenyl] 4-(2-methylprop-2-enoyloxymethoxy)benzoate (PubChem CID 59360270) has the molecular formula C24H18F2O5 and a molecular weight of 424.40 g/mol. Its IUPAC name is [2-fluoro-4-(4-fluorophenyl)phenyl] 4-(2-methylprop-2-enoyloxymethoxy)benzoate.
| Compound Name | [2-fluoro-4-(4-fluorophenyl)phenyl] 4-(2-methylprop-2-enoyloxymethoxy)benzoate |
|---|---|
| PubChem CID | 59360270 |
| Molecular Formula | C24H18F2O5 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | [2-fluoro-4-(4-fluorophenyl)phenyl] 4-(2-methylprop-2-enoyloxymethoxy)benzoate |
| SMILES | C=C(C)C(=O)OCOc1ccc(C(=O)Oc2ccc(-c3ccc(F)cc3)cc2F)cc1 |
| InChI | InChI=1S/C24H18F2O5/c1-15(2)23(27)30-14-29-20-10-5-17(6-11-20)24(28)31-22-12-7-18(13-21(22)26)16-3-8-19(25)9-4-16/h3-13H,1,14H2,2H3 |
| InChIKey | VDXNATNMPBJNCT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|