C32H26O7 — CID 58471467
[6-[4-(prop-2-enoyloxymethyl)phenyl]naphthalen-2-yl] 4-(2-methylprop-2-enoyloxymethoxy)benzoate (PubChem CID 58471467) has the molecular formula C32H26O7 and a molecular weight of 522.55 g/mol. Its IUPAC name is [6-[4-(prop-2-enoyloxymethyl)phenyl]naphthalen-2-yl] 4-(2-methylprop-2-enoyloxymethoxy)benzoate.
| Compound Name | [6-[4-(prop-2-enoyloxymethyl)phenyl]naphthalen-2-yl] 4-(2-methylprop-2-enoyloxymethoxy)benzoate |
|---|---|
| PubChem CID | 58471467 |
| Molecular Formula | C32H26O7 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | [6-[4-(prop-2-enoyloxymethyl)phenyl]naphthalen-2-yl] 4-(2-methylprop-2-enoyloxymethoxy)benzoate |
| SMILES | C=CC(=O)OCc1ccc(-c2ccc3cc(OC(=O)c4ccc(OCOC(=O)C(=C)C)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C32H26O7/c1-4-30(33)36-19-22-5-7-23(8-6-22)25-9-10-27-18-29(16-13-26(27)17-25)39-32(35)24-11-14-28(15-12-24)37-20-38-31(34)21(2)3/h4-18H,1-2,19-20H2,3H3 |
| InChIKey | MIJLFQNFSDFPPN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|