C34H30O7 — CID 58471505
[2,3-dimethyl-4-(2-methylprop-2-enoyloxymethoxy)phenyl] 6-[4-(prop-2-enoyloxymethyl)phenyl]naphthalene-2-carboxylate (PubChem CID 58471505) has the molecular formula C34H30O7 and a molecular weight of 550.61 g/mol. Its IUPAC name is [2,3-dimethyl-4-(2-methylprop-2-enoyloxymethoxy)phenyl] 6-[4-(prop-2-enoyloxymethyl)phenyl]naphthalene-2-carboxylate.
| Compound Name | [2,3-dimethyl-4-(2-methylprop-2-enoyloxymethoxy)phenyl] 6-[4-(prop-2-enoyloxymethyl)phenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58471505 |
| Molecular Formula | C34H30O7 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | [2,3-dimethyl-4-(2-methylprop-2-enoyloxymethoxy)phenyl] 6-[4-(prop-2-enoyloxymethyl)phenyl]naphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCc1ccc(-c2ccc3cc(C(=O)Oc4ccc(OCOC(=O)C(=C)C)c(C)c4C)ccc3c2)cc1 |
| InChI | InChI=1S/C34H30O7/c1-6-32(35)38-19-24-7-9-25(10-8-24)26-11-12-28-18-29(14-13-27(28)17-26)34(37)41-31-16-15-30(22(4)23(31)5)39-20-40-33(36)21(2)3/h6-18H,1-2,19-20H2,3-5H3 |
| InChIKey | YLEGEBCXHFWNDC-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|