C35H32O8 — CID 58471478
[3,5-dimethyl-4-(2-methylprop-2-enoyloxymethoxy)phenyl] 4-[6-(2-methylprop-2-enoyloxymethoxy)naphthalen-2-yl]benzoate (PubChem CID 58471478) has the molecular formula C35H32O8 and a molecular weight of 580.63 g/mol. Its IUPAC name is [3,5-dimethyl-4-(2-methylprop-2-enoyloxymethoxy)phenyl] 4-[6-(2-methylprop-2-enoyloxymethoxy)naphthalen-2-yl]benzoate.
| Compound Name | [3,5-dimethyl-4-(2-methylprop-2-enoyloxymethoxy)phenyl] 4-[6-(2-methylprop-2-enoyloxymethoxy)naphthalen-2-yl]benzoate |
|---|---|
| PubChem CID | 58471478 |
| Molecular Formula | C35H32O8 |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | [3,5-dimethyl-4-(2-methylprop-2-enoyloxymethoxy)phenyl] 4-[6-(2-methylprop-2-enoyloxymethoxy)naphthalen-2-yl]benzoate |
| SMILES | C=C(C)C(=O)OCOc1ccc2cc(-c3ccc(C(=O)Oc4cc(C)c(OCOC(=O)C(=C)C)c(C)c4)cc3)ccc2c1 |
| InChI | InChI=1S/C35H32O8/c1-21(2)33(36)41-19-39-30-14-13-28-17-27(11-12-29(28)18-30)25-7-9-26(10-8-25)35(38)43-31-15-23(5)32(24(6)16-31)40-20-42-34(37)22(3)4/h7-18H,1,3,19-20H2,2,4-6H3 |
| InChIKey | LQNLZJNWFHRBCN-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|