C28H27NO8 — CID 67914651
[4-(4-ethoxyphenyl)-2-nitrophenyl] 4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoate (PubChem CID 67914651) has the molecular formula C28H27NO8 and a molecular weight of 505.52 g/mol. Its IUPAC name is [4-(4-ethoxyphenyl)-2-nitrophenyl] 4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoate.
| Compound Name | [4-(4-ethoxyphenyl)-2-nitrophenyl] 4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoate |
|---|---|
| PubChem CID | 67914651 |
| Molecular Formula | C28H27NO8 |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | [4-(4-ethoxyphenyl)-2-nitrophenyl] 4-[3-(2-methylprop-2-enoyloxy)propoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OCC)cc3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H27NO8/c1-4-34-23-11-6-20(7-12-23)22-10-15-26(25(18-22)29(32)33)37-28(31)21-8-13-24(14-9-21)35-16-5-17-36-27(30)19(2)3/h6-15,18H,2,4-5,16-17H2,1,3H3 |
| InChIKey | BTXLGAJEEBWCHM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|