C35H40O7 — CID 58027852
pentyl 4-[4-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoyl]oxyphenyl]benzoate (PubChem CID 58027852) has the molecular formula C35H40O7 and a molecular weight of 572.70 g/mol. Its IUPAC name is pentyl 4-[4-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoyl]oxyphenyl]benzoate.
| Compound Name | pentyl 4-[4-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoyl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 58027852 |
| Molecular Formula | C35H40O7 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | pentyl 4-[4-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoyl]oxyphenyl]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C(=O)OCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H40O7/c1-4-5-8-24-41-34(37)29-13-11-27(12-14-29)28-15-21-32(22-16-28)42-35(38)30-17-19-31(20-18-30)39-23-9-6-7-10-25-40-33(36)26(2)3/h11-22H,2,4-10,23-25H2,1,3H3 |
| InChIKey | GCXONXSQTMESMU-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|