C44H56O10 — CID 58019596
[4-[4-[8-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]octoxy]benzoyl]oxyphenyl] 4-hexoxybenzoate (PubChem CID 58019596) has the molecular formula C44H56O10 and a molecular weight of 744.92 g/mol. Its IUPAC name is [4-[4-[8-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]octoxy]benzoyl]oxyphenyl] 4-hexoxybenzoate.
| Compound Name | [4-[4-[8-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]octoxy]benzoyl]oxyphenyl] 4-hexoxybenzoate |
|---|---|
| PubChem CID | 58019596 |
| Molecular Formula | C44H56O10 |
| Molecular Weight | 744.92 g/mol |
| Exact Mass | 744.39 |
| IUPAC Name | [4-[4-[8-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]octoxy]benzoyl]oxyphenyl] 4-hexoxybenzoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)OCCCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C44H56O10/c1-4-5-6-13-30-49-37-22-18-35(19-23-37)43(47)53-39-26-28-40(29-27-39)54-44(48)36-20-24-38(25-21-36)50-31-14-9-7-8-10-15-32-51-41(45)17-12-11-16-33-52-42(46)34(2)3/h18-29H,2,4-17,30-33H2,1,3H3 |
| InChIKey | RJYMHMZFQFRYBU-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.92 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|