C30H36O7 — CID 70290580
4-(2-methylprop-2-enoyloxy)-2-[[4-(4-octoxybenzoyl)oxyphenyl]methylidene]butanoic acid (PubChem CID 70290580) has the molecular formula C30H36O7 and a molecular weight of 508.61 g/mol. Its IUPAC name is 4-(2-methylprop-2-enoyloxy)-2-[[4-(4-octoxybenzoyl)oxyphenyl]methylidene]butanoic acid.
| Compound Name | 4-(2-methylprop-2-enoyloxy)-2-[[4-(4-octoxybenzoyl)oxyphenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 70290580 |
| Molecular Formula | C30H36O7 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 4-(2-methylprop-2-enoyloxy)-2-[[4-(4-octoxybenzoyl)oxyphenyl]methylidene]butanoic acid |
| SMILES | C=C(C)C(=O)OCCC(=Cc1ccc(OC(=O)c2ccc(OCCCCCCCC)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C30H36O7/c1-4-5-6-7-8-9-19-35-26-16-12-24(13-17-26)30(34)37-27-14-10-23(11-15-27)21-25(28(31)32)18-20-36-29(33)22(2)3/h10-17,21H,2,4-9,18-20H2,1,3H3,(H,31,32) |
| InChIKey | DMPYGPPXSJNADL-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|