C27H32O7 — CID 101260763
[4-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]phenyl] 4-butoxybenzoate (PubChem CID 101260763) has the molecular formula C27H32O7 and a molecular weight of 468.55 g/mol. Its IUPAC name is [4-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]phenyl] 4-butoxybenzoate.
| Compound Name | [4-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]phenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 101260763 |
| Molecular Formula | C27H32O7 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | [4-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]phenyl] 4-butoxybenzoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)Oc1ccc(OC(=O)c2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C27H32O7/c1-4-5-18-31-22-12-10-21(11-13-22)27(30)34-24-16-14-23(15-17-24)33-25(28)9-7-6-8-19-32-26(29)20(2)3/h10-17H,2,4-9,18-19H2,1,3H3 |
| InChIKey | WDWPFEBMPNFQDZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|