C42H58O10 — CID 58019592
[4-[4-[6-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]hexoxy]cyclohexanecarbonyl]oxyphenyl] 4-hexoxybenzoate (PubChem CID 58019592) has the molecular formula C42H58O10 and a molecular weight of 722.92 g/mol. Its IUPAC name is [4-[4-[6-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]hexoxy]cyclohexanecarbonyl]oxyphenyl] 4-hexoxybenzoate.
| Compound Name | [4-[4-[6-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]hexoxy]cyclohexanecarbonyl]oxyphenyl] 4-hexoxybenzoate |
|---|---|
| PubChem CID | 58019592 |
| Molecular Formula | C42H58O10 |
| Molecular Weight | 722.92 g/mol |
| Exact Mass | 722.40 |
| IUPAC Name | [4-[4-[6-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]hexoxy]cyclohexanecarbonyl]oxyphenyl] 4-hexoxybenzoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)OCCCCCCOC1CCC(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCC)cc3)cc2)CC1 |
| InChI | InChI=1S/C42H58O10/c1-4-5-6-11-28-47-35-20-16-33(17-21-35)41(45)51-37-24-26-38(27-25-37)52-42(46)34-18-22-36(23-19-34)48-29-12-7-8-13-30-49-39(43)15-10-9-14-31-50-40(44)32(2)3/h16-17,20-21,24-27,34,36H,2,4-15,18-19,22-23,28-31H2,1,3H3 |
| InChIKey | MIZOGTXWIQFCEU-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.92 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|