C52H78O9 — CID 162775598
1-O-nonyl 4-O-[8-[4-[4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenoxy]carbonylphenoxy]octyl] butanedioate (PubChem CID 162775598) has the molecular formula C52H78O9 and a molecular weight of 847.19 g/mol. Its IUPAC name is 1-O-nonyl 4-O-[8-[4-[4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenoxy]carbonylphenoxy]octyl] butanedioate.
| Compound Name | 1-O-nonyl 4-O-[8-[4-[4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenoxy]carbonylphenoxy]octyl] butanedioate |
|---|---|
| PubChem CID | 162775598 |
| Molecular Formula | C52H78O9 |
| Molecular Weight | 847.19 g/mol |
| Exact Mass | 846.56 |
| IUPAC Name | 1-O-nonyl 4-O-[8-[4-[4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenoxy]carbonylphenoxy]octyl] butanedioate |
| SMILES | CCCCCCCCCOC(=O)CCC(=O)OCCCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)C3CCC(C4CCC(CCCCC)CC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C52H78O9/c1-3-5-7-8-9-13-17-39-58-49(53)36-37-50(54)59-40-18-14-11-10-12-16-38-57-46-30-28-45(29-31-46)52(56)61-48-34-32-47(33-35-48)60-51(55)44-26-24-43(25-27-44)42-22-20-41(21-23-42)19-15-6-4-2/h28-35,41-44H,3-27,36-40H2,1-2H3 |
| InChIKey | FUTBGYDWTIYRMP-UHFFFAOYSA-N |
| XLogP | 13.34 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.19 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|