C54H76O8 — CID 163298204
8-[4-[4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenoxy]carbonylphenoxy]octyl 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 163298204) has the molecular formula C54H76O8 and a molecular weight of 853.19 g/mol. Its IUPAC name is 8-[4-[4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenoxy]carbonylphenoxy]octyl 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | 8-[4-[4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenoxy]carbonylphenoxy]octyl 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 163298204 |
| Molecular Formula | C54H76O8 |
| Molecular Weight | 853.19 g/mol |
| Exact Mass | 852.55 |
| IUPAC Name | 8-[4-[4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenoxy]carbonylphenoxy]octyl 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | CCCCCC1CCC(C2CCC(C(=O)Oc3ccc(OC(=O)c4ccc(OCCCCCCCCOC(=O)c5cc(C(C)(C)C)c(O)c(C(C)(C)C)c5)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C54H76O8/c1-8-9-14-17-38-18-20-39(21-19-38)40-22-24-41(25-23-40)51(57)61-45-30-32-46(33-31-45)62-52(58)42-26-28-44(29-27-42)59-34-15-12-10-11-13-16-35-60-50(56)43-36-47(53(2,3)4)49(55)48(37-43)54(5,6)7/h26-33,36-41,55H,8-25,34-35H2,1-7H3 |
| InChIKey | PVOTYEBVRGBGBD-UHFFFAOYSA-N |
| XLogP | 13.88 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.19 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|