C39H56O6 — CID 162775643
[4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenyl] 4-(8-hydroxyoctoxy)benzoate (PubChem CID 162775643) has the molecular formula C39H56O6 and a molecular weight of 620.87 g/mol. Its IUPAC name is [4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenyl] 4-(8-hydroxyoctoxy)benzoate.
| Compound Name | [4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenyl] 4-(8-hydroxyoctoxy)benzoate |
|---|---|
| PubChem CID | 162775643 |
| Molecular Formula | C39H56O6 |
| Molecular Weight | 620.87 g/mol |
| Exact Mass | 620.41 |
| IUPAC Name | [4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenyl] 4-(8-hydroxyoctoxy)benzoate |
| SMILES | CCCCCC1CCC(C2CCC(C(=O)Oc3ccc(OC(=O)c4ccc(OCCCCCCCCO)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C39H56O6/c1-2-3-8-11-30-12-14-31(15-13-30)32-16-18-33(19-17-32)38(41)44-36-24-26-37(27-25-36)45-39(42)34-20-22-35(23-21-34)43-29-10-7-5-4-6-9-28-40/h20-27,30-33,40H,2-19,28-29H2,1H3 |
| InChIKey | YEFWAYPKQUDJIE-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.87 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|