C27H42O4 — CID 139725405
octyl 4-(4-pentylcyclohexanecarbonyl)oxybenzoate (PubChem CID 139725405) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is octyl 4-(4-pentylcyclohexanecarbonyl)oxybenzoate.
| Compound Name | octyl 4-(4-pentylcyclohexanecarbonyl)oxybenzoate |
|---|---|
| PubChem CID | 139725405 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | octyl 4-(4-pentylcyclohexanecarbonyl)oxybenzoate |
| SMILES | CCCCCCCCOC(=O)c1ccc(OC(=O)C2CCC(CCCCC)CC2)cc1 |
| InChI | InChI=1S/C27H42O4/c1-3-5-7-8-9-11-21-30-26(28)23-17-19-25(20-18-23)31-27(29)24-15-13-22(14-16-24)12-10-6-4-2/h17-20,22,24H,3-16,21H2,1-2H3 |
| InChIKey | HYPOXBGTJIREQO-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|