C34H45NO4 — CID 101195962
nonyl 6-[2-[4-(4-butylcyclohexanecarbonyl)oxyphenyl]ethynyl]pyridine-3-carboxylate (PubChem CID 101195962) has the molecular formula C34H45NO4 and a molecular weight of 531.74 g/mol. Its IUPAC name is nonyl 6-[2-[4-(4-butylcyclohexanecarbonyl)oxyphenyl]ethynyl]pyridine-3-carboxylate.
| Compound Name | nonyl 6-[2-[4-(4-butylcyclohexanecarbonyl)oxyphenyl]ethynyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 101195962 |
| Molecular Formula | C34H45NO4 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | nonyl 6-[2-[4-(4-butylcyclohexanecarbonyl)oxyphenyl]ethynyl]pyridine-3-carboxylate |
| SMILES | CCCCCCCCCOC(=O)c1ccc(C#Cc2ccc(OC(=O)C3CCC(CCCC)CC3)cc2)nc1 |
| InChI | InChI=1S/C34H45NO4/c1-3-5-7-8-9-10-11-25-38-33(36)30-20-22-31(35-26-30)21-15-28-16-23-32(24-17-28)39-34(37)29-18-13-27(14-19-29)12-6-4-2/h16-17,20,22-24,26-27,29H,3-14,18-19,25H2,1-2H3 |
| InChIKey | FNFWJRBTMSVMQU-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|