C29H32O2 — CID 67827345
[4-[2-(4-but-1-ynylphenyl)ethynyl]phenyl] 4-butylcyclohexane-1-carboxylate (PubChem CID 67827345) has the molecular formula C29H32O2 and a molecular weight of 412.57 g/mol. Its IUPAC name is [4-[2-(4-but-1-ynylphenyl)ethynyl]phenyl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [4-[2-(4-but-1-ynylphenyl)ethynyl]phenyl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67827345 |
| Molecular Formula | C29H32O2 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | [4-[2-(4-but-1-ynylphenyl)ethynyl]phenyl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCC#Cc1ccc(C#Cc2ccc(OC(=O)C3CCC(CCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H32O2/c1-3-5-7-23-9-11-25(12-10-23)13-14-26-17-21-28(22-18-26)31-29(30)27-19-15-24(16-20-27)8-6-4-2/h9-12,17-18,21-22,24,27H,3-4,6,8,15-16,19-20H2,1-2H3 |
| InChIKey | XIQLNYLOWZAHMT-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|