C32H38F4O3 — CID 100951436
[4-[2-(2,3,5,6-tetrafluoro-4-hexoxyphenyl)ethynyl]phenyl] 4-pentylcyclohexane-1-carboxylate (PubChem CID 100951436) has the molecular formula C32H38F4O3 and a molecular weight of 546.65 g/mol. Its IUPAC name is [4-[2-(2,3,5,6-tetrafluoro-4-hexoxyphenyl)ethynyl]phenyl] 4-pentylcyclohexane-1-carboxylate.
| Compound Name | [4-[2-(2,3,5,6-tetrafluoro-4-hexoxyphenyl)ethynyl]phenyl] 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 100951436 |
| Molecular Formula | C32H38F4O3 |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | [4-[2-(2,3,5,6-tetrafluoro-4-hexoxyphenyl)ethynyl]phenyl] 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCCOc1c(F)c(F)c(C#Cc2ccc(OC(=O)C3CCC(CCCCC)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C32H38F4O3/c1-3-5-7-9-21-38-31-29(35)27(33)26(28(34)30(31)36)20-15-23-13-18-25(19-14-23)39-32(37)24-16-11-22(12-17-24)10-8-6-4-2/h13-14,18-19,22,24H,3-12,16-17,21H2,1-2H3 |
| InChIKey | DSPIBRLMHFNFRM-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|