C25H38F2O3 — CID 19103478
(2,3-difluoro-4-heptoxyphenyl) 4-pentylcyclohexane-1-carboxylate (PubChem CID 19103478) has the molecular formula C25H38F2O3 and a molecular weight of 424.57 g/mol. Its IUPAC name is (2,3-difluoro-4-heptoxyphenyl) 4-pentylcyclohexane-1-carboxylate.
| Compound Name | (2,3-difluoro-4-heptoxyphenyl) 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19103478 |
| Molecular Formula | C25H38F2O3 |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (2,3-difluoro-4-heptoxyphenyl) 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCCCOc1ccc(OC(=O)C2CCC(CCCCC)CC2)c(F)c1F |
| InChI | InChI=1S/C25H38F2O3/c1-3-5-7-8-10-18-29-21-16-17-22(24(27)23(21)26)30-25(28)20-14-12-19(13-15-20)11-9-6-4-2/h16-17,19-20H,3-15,18H2,1-2H3 |
| InChIKey | GKSMPRBVFSEXLA-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|