C34H45F3O3 — CID 88997781
[4-(4-butoxy-3-fluorophenyl)-2,3-difluorophenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 88997781) has the molecular formula C34H45F3O3 and a molecular weight of 558.73 g/mol. Its IUPAC name is [4-(4-butoxy-3-fluorophenyl)-2,3-difluorophenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(4-butoxy-3-fluorophenyl)-2,3-difluorophenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88997781 |
| Molecular Formula | C34H45F3O3 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | [4-(4-butoxy-3-fluorophenyl)-2,3-difluorophenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C2CCC(C(=O)Oc3ccc(-c4ccc(OCCCC)c(F)c4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C34H45F3O3/c1-3-5-7-8-23-9-11-24(12-10-23)25-13-15-26(16-14-25)34(38)40-31-20-18-28(32(36)33(31)37)27-17-19-30(29(35)22-27)39-21-6-4-2/h17-20,22-26H,3-16,21H2,1-2H3 |
| InChIKey | DHJPYMILNLRCHL-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|