C27H40F2O3 — CID 70398741
[2,3-difluoro-4-(4-propylcyclohexyl)oxyphenyl] 4-pentylcyclohexane-1-carboxylate (PubChem CID 70398741) has the molecular formula C27H40F2O3 and a molecular weight of 450.61 g/mol. Its IUPAC name is [2,3-difluoro-4-(4-propylcyclohexyl)oxyphenyl] 4-pentylcyclohexane-1-carboxylate.
| Compound Name | [2,3-difluoro-4-(4-propylcyclohexyl)oxyphenyl] 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70398741 |
| Molecular Formula | C27H40F2O3 |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | [2,3-difluoro-4-(4-propylcyclohexyl)oxyphenyl] 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)Oc2ccc(OC3CCC(CCC)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C27H40F2O3/c1-3-5-6-8-20-9-13-21(14-10-20)27(30)32-24-18-17-23(25(28)26(24)29)31-22-15-11-19(7-4-2)12-16-22/h17-22H,3-16H2,1-2H3 |
| InChIKey | ZYOPQXJSTUIEBF-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|