C34H50F2N2O3 — CID 70398740
[2,3-difluoro-4-(4-propylcyclohexyl)oxyphenyl] 4-pentylcyclohexane-1-carboxylate;N,N-dimethylpyridin-4-amine (PubChem CID 70398740) has the molecular formula C34H50F2N2O3 and a molecular weight of 572.78 g/mol. Its IUPAC name is [2,3-difluoro-4-(4-propylcyclohexyl)oxyphenyl] 4-pentylcyclohexane-1-carboxylate;N,N-dimethylpyridin-4-amine.
| Compound Name | [2,3-difluoro-4-(4-propylcyclohexyl)oxyphenyl] 4-pentylcyclohexane-1-carboxylate;N,N-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 70398740 |
| Molecular Formula | C34H50F2N2O3 |
| Molecular Weight | 572.78 g/mol |
| Exact Mass | 572.38 |
| IUPAC Name | [2,3-difluoro-4-(4-propylcyclohexyl)oxyphenyl] 4-pentylcyclohexane-1-carboxylate;N,N-dimethylpyridin-4-amine |
| SMILES | CCCCCC1CCC(C(=O)Oc2ccc(OC3CCC(CCC)CC3)c(F)c2F)CC1.CN(C)c1ccncc1 |
| InChI | InChI=1S/C27H40F2O3.C7H10N2/c1-3-5-6-8-20-9-13-21(14-10-20)27(30)32-24-18-17-23(25(28)26(24)29)31-22-15-11-19(7-4-2)12-16-22;1-9(2)7-3-5-8-6-4-7/h17-22H,3-16H2,1-2H3;3-6H,1-2H3 |
| InChIKey | TWLAAFJCHBIELI-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.78 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|