C26H38F2O2S — CID 58299365
[2,3-difluoro-4-[(4-pentylcyclohexyl)methylsulfanyl]phenyl] 4-methylcyclohexane-1-carboxylate (PubChem CID 58299365) has the molecular formula C26H38F2O2S and a molecular weight of 452.65 g/mol. Its IUPAC name is [2,3-difluoro-4-[(4-pentylcyclohexyl)methylsulfanyl]phenyl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | [2,3-difluoro-4-[(4-pentylcyclohexyl)methylsulfanyl]phenyl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58299365 |
| Molecular Formula | C26H38F2O2S |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | [2,3-difluoro-4-[(4-pentylcyclohexyl)methylsulfanyl]phenyl] 4-methylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(CSc2ccc(OC(=O)C3CCC(C)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C26H38F2O2S/c1-3-4-5-6-19-9-11-20(12-10-19)17-31-23-16-15-22(24(27)25(23)28)30-26(29)21-13-7-18(2)8-14-21/h15-16,18-21H,3-14,17H2,1-2H3 |
| InChIKey | UEYISTSOWTZVDA-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|