C38H60F2O4 — CID 19793037
[2,3-difluoro-4-(4-nonylcyclohexanecarbonyl)oxyphenyl] 4-nonylcyclohexane-1-carboxylate (PubChem CID 19793037) has the molecular formula C38H60F2O4 and a molecular weight of 618.89 g/mol. Its IUPAC name is [2,3-difluoro-4-(4-nonylcyclohexanecarbonyl)oxyphenyl] 4-nonylcyclohexane-1-carboxylate.
| Compound Name | [2,3-difluoro-4-(4-nonylcyclohexanecarbonyl)oxyphenyl] 4-nonylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19793037 |
| Molecular Formula | C38H60F2O4 |
| Molecular Weight | 618.89 g/mol |
| Exact Mass | 618.45 |
| IUPAC Name | [2,3-difluoro-4-(4-nonylcyclohexanecarbonyl)oxyphenyl] 4-nonylcyclohexane-1-carboxylate |
| SMILES | CCCCCCCCCC1CCC(C(=O)Oc2ccc(OC(=O)C3CCC(CCCCCCCCC)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C38H60F2O4/c1-3-5-7-9-11-13-15-17-29-19-23-31(24-20-29)37(41)43-33-27-28-34(36(40)35(33)39)44-38(42)32-25-21-30(22-26-32)18-16-14-12-10-8-6-4-2/h27-32H,3-26H2,1-2H3 |
| InChIKey | KRZJAHGQRPHRFZ-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.89 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|