C26H40F2O2 — CID 19103628
(2,3-difluoro-4-pentylphenyl) 4-octylcyclohexane-1-carboxylate (PubChem CID 19103628) has the molecular formula C26H40F2O2 and a molecular weight of 422.60 g/mol. Its IUPAC name is (2,3-difluoro-4-pentylphenyl) 4-octylcyclohexane-1-carboxylate.
| Compound Name | (2,3-difluoro-4-pentylphenyl) 4-octylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19103628 |
| Molecular Formula | C26H40F2O2 |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | (2,3-difluoro-4-pentylphenyl) 4-octylcyclohexane-1-carboxylate |
| SMILES | CCCCCCCCC1CCC(C(=O)Oc2ccc(CCCCC)c(F)c2F)CC1 |
| InChI | InChI=1S/C26H40F2O2/c1-3-5-7-8-9-11-12-20-14-16-22(17-15-20)26(29)30-23-19-18-21(13-10-6-4-2)24(27)25(23)28/h18-20,22H,3-17H2,1-2H3 |
| InChIKey | IXXYTTVWDTWFPU-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|