C33H48F2O2 — CID 139867433
[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl] 4-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate (PubChem CID 139867433) has the molecular formula C33H48F2O2 and a molecular weight of 514.74 g/mol. Its IUPAC name is [2,3-difluoro-4-[(E)-pent-3-enyl]phenyl] 4-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate.
| Compound Name | [2,3-difluoro-4-[(E)-pent-3-enyl]phenyl] 4-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139867433 |
| Molecular Formula | C33H48F2O2 |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.36 |
| IUPAC Name | [2,3-difluoro-4-[(E)-pent-3-enyl]phenyl] 4-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
| SMILES | C/C=C/CCc1ccc(OC(=O)C2CCC(C3CCC4CC(CCCCC)CCC4C3)CC2)c(F)c1F |
| InChI | InChI=1S/C33H48F2O2/c1-3-5-7-9-23-11-12-29-22-28(18-17-27(29)21-23)24-13-15-26(16-14-24)33(36)37-30-20-19-25(10-8-6-4-2)31(34)32(30)35/h4,6,19-20,23-24,26-29H,3,5,7-18,21-22H2,1-2H3/b6-4+ |
| InChIKey | GUEKZNUHXLREJG-GQCTYLIASA-N |
| XLogP | 9.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|