C33H47FO2 — CID 139866236
[3-fluoro-4-[(E)-pent-3-enyl]phenyl] 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate (PubChem CID 139866236) has the molecular formula C33H47FO2 and a molecular weight of 494.74 g/mol. Its IUPAC name is [3-fluoro-4-[(E)-pent-3-enyl]phenyl] 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate.
| Compound Name | [3-fluoro-4-[(E)-pent-3-enyl]phenyl] 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139866236 |
| Molecular Formula | C33H47FO2 |
| Molecular Weight | 494.74 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | [3-fluoro-4-[(E)-pent-3-enyl]phenyl] 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate |
| SMILES | C/C=C/CCc1ccc(OC(=O)C2CCC(C3CCC4CC(CC/C=C/C)CCC4C3)CC2)cc1F |
| InChI | InChI=1S/C33H47FO2/c1-3-5-7-9-24-11-12-30-22-29(18-17-28(30)21-24)25-13-15-27(16-14-25)33(35)36-31-20-19-26(32(34)23-31)10-8-6-4-2/h3-6,19-20,23-25,27-30H,7-18,21-22H2,1-2H3/b5-3+,6-4+ |
| InChIKey | MUFIAPKYUIDZKQ-GGWOSOGESA-N |
| XLogP | 9.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.74 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|