C30H41FO3 — CID 139868366
[4-[(E)-but-2-enoxy]-3-fluorophenyl] 4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate (PubChem CID 139868366) has the molecular formula C30H41FO3 and a molecular weight of 468.65 g/mol. Its IUPAC name is [4-[(E)-but-2-enoxy]-3-fluorophenyl] 4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-but-2-enoxy]-3-fluorophenyl] 4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139868366 |
| Molecular Formula | C30H41FO3 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | [4-[(E)-but-2-enoxy]-3-fluorophenyl] 4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate |
| SMILES | C/C=C/COc1ccc(OC(=O)C2CCC(C3CCC4CC(/C=C/C)CCC4C3)CC2)cc1F |
| InChI | InChI=1S/C30H41FO3/c1-3-5-17-33-29-16-15-27(20-28(29)31)34-30(32)23-11-9-22(10-12-23)25-14-13-24-18-21(6-4-2)7-8-26(24)19-25/h3-6,15-16,20-26H,7-14,17-19H2,1-2H3/b5-3+,6-4+ |
| InChIKey | JELMZQWXNRBTNS-GGWOSOGESA-N |
| XLogP | 7.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|