C27H34FNO2 — CID 139868849
(4-cyano-2-fluorophenyl) 4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate (PubChem CID 139868849) has the molecular formula C27H34FNO2 and a molecular weight of 423.57 g/mol. Its IUPAC name is (4-cyano-2-fluorophenyl) 4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate.
| Compound Name | (4-cyano-2-fluorophenyl) 4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139868849 |
| Molecular Formula | C27H34FNO2 |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (4-cyano-2-fluorophenyl) 4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexane-1-carboxylate |
| SMILES | C/C=C/C1CCC2CC(C3CCC(C(=O)Oc4ccc(C#N)cc4F)CC3)CCC2C1 |
| InChI | InChI=1S/C27H34FNO2/c1-2-3-18-4-6-24-16-23(12-11-22(24)14-18)20-7-9-21(10-8-20)27(30)31-26-13-5-19(17-29)15-25(26)28/h2-3,5,13,15,18,20-24H,4,6-12,14,16H2,1H3/b3-2+ |
| InChIKey | RMVCIEXQHBYZQM-NSCUHMNNSA-N |
| XLogP | 6.82 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|