C28H29F3O — CID 139866710
2-[3,5-difluoro-4-[2-(3-fluoro-4-methoxyphenyl)ethynyl]phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139866710) has the molecular formula C28H29F3O and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-[2-(3-fluoro-4-methoxyphenyl)ethynyl]phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[3,5-difluoro-4-[2-(3-fluoro-4-methoxyphenyl)ethynyl]phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139866710 |
| Molecular Formula | C28H29F3O |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 2-[3,5-difluoro-4-[2-(3-fluoro-4-methoxyphenyl)ethynyl]phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/C1CCC2CC(c3cc(F)c(C#Cc4ccc(OC)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C28H29F3O/c1-3-4-18-5-8-21-15-22(10-9-20(21)13-18)23-16-25(29)24(26(30)17-23)11-6-19-7-12-28(32-2)27(31)14-19/h3-4,7,12,14,16-18,20-22H,5,8-10,13,15H2,1-2H3/b4-3+ |
| InChIKey | BIUFMRNSWPZXHP-ONEGZZNKSA-N |
| XLogP | 7.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|