C27H27F5O2 — CID 139870176
2-[4-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethynyl]-3,5-difluorophenyl]-6-ethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139870176) has the molecular formula C27H27F5O2 and a molecular weight of 478.50 g/mol. Its IUPAC name is 2-[4-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethynyl]-3,5-difluorophenyl]-6-ethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethynyl]-3,5-difluorophenyl]-6-ethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139870176 |
| Molecular Formula | C27H27F5O2 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-[4-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethynyl]-3,5-difluorophenyl]-6-ethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCOC1CCC2CC(c3cc(F)c(C#Cc4ccc(OC(F)F)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C27H27F5O2/c1-2-33-21-8-7-17-12-18(5-6-19(17)13-21)20-14-23(28)22(24(29)15-20)9-3-16-4-10-26(25(30)11-16)34-27(31)32/h4,10-11,14-15,17-19,21,27H,2,5-8,12-13H2,1H3 |
| InChIKey | VMQIJPLAYHWYLG-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|