C26H27ClF2O — CID 139866799
2-[4-[2-(4-chlorophenyl)ethynyl]-3,5-difluorophenyl]-6-ethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139866799) has the molecular formula C26H27ClF2O and a molecular weight of 428.95 g/mol. Its IUPAC name is 2-[4-[2-(4-chlorophenyl)ethynyl]-3,5-difluorophenyl]-6-ethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[2-(4-chlorophenyl)ethynyl]-3,5-difluorophenyl]-6-ethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139866799 |
| Molecular Formula | C26H27ClF2O |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-[4-[2-(4-chlorophenyl)ethynyl]-3,5-difluorophenyl]-6-ethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCOC1CCC2CC(c3cc(F)c(C#Cc4ccc(Cl)cc4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C26H27ClF2O/c1-2-30-23-11-8-18-13-19(6-7-20(18)14-23)21-15-25(28)24(26(29)16-21)12-5-17-3-9-22(27)10-4-17/h3-4,9-10,15-16,18-20,23H,2,6-8,11,13-14H2,1H3 |
| InChIKey | MFLUDKDLDQSIJA-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|