C19H23ClF2O — CID 139864864
2-(4-chloro-3,5-difluorophenyl)-6-prop-2-enoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139864864) has the molecular formula C19H23ClF2O and a molecular weight of 340.84 g/mol. Its IUPAC name is 2-(4-chloro-3,5-difluorophenyl)-6-prop-2-enoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-(4-chloro-3,5-difluorophenyl)-6-prop-2-enoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139864864 |
| Molecular Formula | C19H23ClF2O |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-(4-chloro-3,5-difluorophenyl)-6-prop-2-enoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCOC1CCC2CC(c3cc(F)c(Cl)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C19H23ClF2O/c1-2-7-23-16-6-5-12-8-13(3-4-14(12)9-16)15-10-17(21)19(20)18(22)11-15/h2,10-14,16H,1,3-9H2 |
| InChIKey | ZODSNDPWDSBQAW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|