C20H25F3O — CID 139864740
2-prop-2-enoxy-6-[4-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139864740) has the molecular formula C20H25F3O and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-prop-2-enoxy-6-[4-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-prop-2-enoxy-6-[4-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139864740 |
| Molecular Formula | C20H25F3O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-prop-2-enoxy-6-[4-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCOC1CCC2CC(c3ccc(C(F)(F)F)cc3)CCC2C1 |
| InChI | InChI=1S/C20H25F3O/c1-2-11-24-19-10-7-16-12-15(3-4-17(16)13-19)14-5-8-18(9-6-14)20(21,22)23/h2,5-6,8-9,15-17,19H,1,3-4,7,10-13H2 |
| InChIKey | SWCGFTLSKCMZTQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|