C25H29F3O — CID 139870442
2-ethoxy-6-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139870442) has the molecular formula C25H29F3O and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-ethoxy-6-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-ethoxy-6-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139870442 |
| Molecular Formula | C25H29F3O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-ethoxy-6-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCOC1CCC2CC(c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)CCC2C1 |
| InChI | InChI=1S/C25H29F3O/c1-2-29-24-14-11-21-15-20(7-8-22(21)16-24)19-5-3-17(4-6-19)18-9-12-23(13-10-18)25(26,27)28/h3-6,9-10,12-13,20-22,24H,2,7-8,11,14-16H2,1H3 |
| InChIKey | ZEUCXDDWDLHGJZ-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |