C21H29F3O2 — CID 139865755
2-butoxy-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139865755) has the molecular formula C21H29F3O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-butoxy-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-butoxy-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139865755 |
| Molecular Formula | C21H29F3O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-butoxy-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCOC1CCC2CC(c3ccc(OC(F)(F)F)cc3)CCC2C1 |
| InChI | InChI=1S/C21H29F3O2/c1-2-3-12-25-20-11-8-17-13-16(4-5-18(17)14-20)15-6-9-19(10-7-15)26-21(22,23)24/h6-7,9-10,16-18,20H,2-5,8,11-14H2,1H3 |
| InChIKey | NZKQUJWXQFUZPG-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|