C27H35F3O — CID 20808457
2-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-(trifluoromethoxy)naphthalene (PubChem CID 20808457) has the molecular formula C27H35F3O and a molecular weight of 432.57 g/mol. Its IUPAC name is 2-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-(trifluoromethoxy)naphthalene.
| Compound Name | 2-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-(trifluoromethoxy)naphthalene |
|---|---|
| PubChem CID | 20808457 |
| Molecular Formula | C27H35F3O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 2-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-(trifluoromethoxy)naphthalene |
| SMILES | CCCCCC[C@@H]1CC[C@@H]2CC(c3ccc4cc(OC(F)(F)F)ccc4c3)CCC2C1 |
| InChI | InChI=1S/C27H35F3O/c1-2-3-4-5-6-19-7-8-21-16-22(10-9-20(21)15-19)23-11-12-25-18-26(31-27(28,29)30)14-13-24(25)17-23/h11-14,17-22H,2-10,15-16H2,1H3/t19-,20?,21-,22?/m1/s1 |
| InChIKey | FTLKALKHEGDCRZ-BJTVZRGDSA-N |
| XLogP | 9.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|