C32H47F5O — CID 139837586
2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6-[2-(4-heptylcyclohexyl)ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139837586) has the molecular formula C32H47F5O and a molecular weight of 542.72 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6-[2-(4-heptylcyclohexyl)ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6-[2-(4-heptylcyclohexyl)ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139837586 |
| Molecular Formula | C32H47F5O |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | 2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6-[2-(4-heptylcyclohexyl)ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCCCC1CCC(CCC2CCC3CC(c4cc(F)c(OC(F)(F)F)c(F)c4)CCC3C2)CC1 |
| InChI | InChI=1S/C32H47F5O/c1-2-3-4-5-6-7-22-8-10-23(11-9-22)12-13-24-14-15-26-19-27(17-16-25(26)18-24)28-20-29(33)31(30(34)21-28)38-32(35,36)37/h20-27H,2-19H2,1H3 |
| InChIKey | RWFDJLNJGRAHAP-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|