C30H38F4O — CID 20808892
(2R,4aR,8aR)-2-[4-(3,5-difluoro-4-methoxyphenyl)-3,5-difluorophenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20808892) has the molecular formula C30H38F4O and a molecular weight of 490.63 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-(3,5-difluoro-4-methoxyphenyl)-3,5-difluorophenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-(3,5-difluoro-4-methoxyphenyl)-3,5-difluorophenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20808892 |
| Molecular Formula | C30H38F4O |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-(3,5-difluoro-4-methoxyphenyl)-3,5-difluorophenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCCCC1CC[C@@H]2C[C@H](c3cc(F)c(-c4cc(F)c(OC)c(F)c4)c(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C30H38F4O/c1-3-4-5-6-7-8-19-9-10-21-14-22(12-11-20(21)13-19)23-15-25(31)29(26(32)16-23)24-17-27(33)30(35-2)28(34)18-24/h15-22H,3-14H2,1-2H3/t19?,20-,21-,22-/m1/s1 |
| InChIKey | BLWBWDJJKLSDHM-QPVBMBBTSA-N |
| XLogP | 9.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|