C33H41F4NO — CID 20808879
2-[4-[4-[(2R,4aR,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2,6-difluorophenyl]-2,6-difluorophenyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 20808879) has the molecular formula C33H41F4NO and a molecular weight of 543.69 g/mol. Its IUPAC name is 2-[4-[4-[(2R,4aR,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2,6-difluorophenyl]-2,6-difluorophenyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[4-[4-[(2R,4aR,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2,6-difluorophenyl]-2,6-difluorophenyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 20808879 |
| Molecular Formula | C33H41F4NO |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | 2-[4-[4-[(2R,4aR,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2,6-difluorophenyl]-2,6-difluorophenyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CCCCCCC1CC[C@@H]2C[C@H](c3cc(F)c(-c4cc(F)c(C5=NC(C)(C)CO5)c(F)c4)c(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C33H41F4NO/c1-4-5-6-7-8-20-9-10-22-14-23(12-11-21(22)13-20)24-15-26(34)30(27(35)16-24)25-17-28(36)31(29(37)18-25)32-38-33(2,3)19-39-32/h15-18,20-23H,4-14,19H2,1-3H3/t20?,21-,22-,23-/m1/s1 |
| InChIKey | OCFBADVBAJBASC-DYJXVCGVSA-N |
| XLogP | 9.74 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|