C31H41NO — CID 20809438
2-[4-[4-[(2R,4aR,8aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]phenyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 20809438) has the molecular formula C31H41NO and a molecular weight of 443.68 g/mol. Its IUPAC name is 2-[4-[4-[(2R,4aR,8aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]phenyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[4-[4-[(2R,4aR,8aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]phenyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 20809438 |
| Molecular Formula | C31H41NO |
| Molecular Weight | 443.68 g/mol |
| Exact Mass | 443.32 |
| IUPAC Name | 2-[4-[4-[(2R,4aR,8aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]phenyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CCCCC1CC[C@@H]2C[C@H](c3ccc(-c4ccc(C5=NC(C)(C)CO5)cc4)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C31H41NO/c1-4-5-6-22-7-8-29-20-28(18-17-27(29)19-22)25-11-9-23(10-12-25)24-13-15-26(16-14-24)30-32-31(2,3)21-33-30/h9-16,22,27-29H,4-8,17-21H2,1-3H3/t22?,27-,28-,29-/m1/s1 |
| InChIKey | FVRRPMWOEXVPCW-HWKPFLBXSA-N |
| XLogP | 8.40 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.68 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |