C27H34F2O — CID 20809473
(4aR,6R,8aR)-2-butyl-6-[4-[4-(difluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809473) has the molecular formula C27H34F2O and a molecular weight of 412.56 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-butyl-6-[4-[4-(difluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-butyl-6-[4-[4-(difluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809473 |
| Molecular Formula | C27H34F2O |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | (4aR,6R,8aR)-2-butyl-6-[4-[4-(difluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCC1CC[C@@H]2C[C@H](c3ccc(-c4ccc(OC(F)F)cc4)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C27H34F2O/c1-2-3-4-19-5-6-25-18-24(12-11-23(25)17-19)22-9-7-20(8-10-22)21-13-15-26(16-14-21)30-27(28)29/h7-10,13-16,19,23-25,27H,2-6,11-12,17-18H2,1H3/t19?,23-,24-,25-/m1/s1 |
| InChIKey | MXRLNAMFVZXXJU-KIZJSLQPSA-N |
| XLogP | 8.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |