C29H36F4O — CID 20809423
(4aR,6R,8aR)-2-pentyl-6-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809423) has the molecular formula C29H36F4O and a molecular weight of 476.60 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-pentyl-6-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-pentyl-6-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809423 |
| Molecular Formula | C29H36F4O |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | (4aR,6R,8aR)-2-pentyl-6-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCC1CC[C@@H]2C[C@H](c3ccc(-c4ccc(OC(F)(F)C(F)F)cc4)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C29H36F4O/c1-2-3-4-5-20-6-7-26-19-25(13-12-24(26)18-20)23-10-8-21(9-11-23)22-14-16-27(17-15-22)34-29(32,33)28(30)31/h8-11,14-17,20,24-26,28H,2-7,12-13,18-19H2,1H3/t20?,24-,25-,26-/m1/s1 |
| InChIKey | DKYZWHRETXSPTG-GRXQTZIKSA-N |
| XLogP | 9.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|