C32H46F6O — CID 22080296
1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]benzene (PubChem CID 22080296) has the molecular formula C32H46F6O and a molecular weight of 560.71 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 22080296 |
| Molecular Formula | C32H46F6O |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.35 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]benzene |
| SMILES | CCCCCC1CCC(C2CCC(C3CCC(c4ccc(OC(F)(F)C(F)C(F)(F)F)cc4)CC3)CC2)CC1 |
| InChI | InChI=1S/C32H46F6O/c1-2-3-4-5-22-6-8-23(9-7-22)24-10-12-25(13-11-24)26-14-16-27(17-15-26)28-18-20-29(21-19-28)39-32(37,38)30(33)31(34,35)36/h18-27,30H,2-17H2,1H3 |
| InChIKey | WWPYCQUCTMAETD-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|