C22H30F6O — CID 23193009
1-(4-heptylcyclohexyl)-4-(1,1,2,3,3,3-hexafluoropropoxy)benzene (PubChem CID 23193009) has the molecular formula C22H30F6O and a molecular weight of 424.47 g/mol. Its IUPAC name is 1-(4-heptylcyclohexyl)-4-(1,1,2,3,3,3-hexafluoropropoxy)benzene.
| Compound Name | 1-(4-heptylcyclohexyl)-4-(1,1,2,3,3,3-hexafluoropropoxy)benzene |
|---|---|
| PubChem CID | 23193009 |
| Molecular Formula | C22H30F6O |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-(4-heptylcyclohexyl)-4-(1,1,2,3,3,3-hexafluoropropoxy)benzene |
| SMILES | CCCCCCCC1CCC(c2ccc(OC(F)(F)C(F)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H30F6O/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)18-12-14-19(15-13-18)29-22(27,28)20(23)21(24,25)26/h12-17,20H,2-11H2,1H3 |
| InChIKey | PWHHBQLMKHPNTL-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|