C20H25F7O — CID 22080156
2-fluoro-1-(1,1,2,3,3,3-hexafluoropropoxy)-4-(4-pentylcyclohexyl)benzene (PubChem CID 22080156) has the molecular formula C20H25F7O and a molecular weight of 414.41 g/mol. Its IUPAC name is 2-fluoro-1-(1,1,2,3,3,3-hexafluoropropoxy)-4-(4-pentylcyclohexyl)benzene.
| Compound Name | 2-fluoro-1-(1,1,2,3,3,3-hexafluoropropoxy)-4-(4-pentylcyclohexyl)benzene |
|---|---|
| PubChem CID | 22080156 |
| Molecular Formula | C20H25F7O |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-fluoro-1-(1,1,2,3,3,3-hexafluoropropoxy)-4-(4-pentylcyclohexyl)benzene |
| SMILES | CCCCCC1CCC(c2ccc(OC(F)(F)C(F)C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C20H25F7O/c1-2-3-4-5-13-6-8-14(9-7-13)15-10-11-17(16(21)12-15)28-20(26,27)18(22)19(23,24)25/h10-14,18H,2-9H2,1H3 |
| InChIKey | OCNZMDOHPPLERG-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|