C26H39F5O2 — CID 159915698
1-(difluoromethoxy)-4-[4-[2,2-difluoro-2-(4-pentylcyclohexyl)ethyl]cyclohexyl]-2-fluorobenzene;hydrate (PubChem CID 159915698) has the molecular formula C26H39F5O2 and a molecular weight of 478.59 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-[4-[2,2-difluoro-2-(4-pentylcyclohexyl)ethyl]cyclohexyl]-2-fluorobenzene;hydrate.
| Compound Name | 1-(difluoromethoxy)-4-[4-[2,2-difluoro-2-(4-pentylcyclohexyl)ethyl]cyclohexyl]-2-fluorobenzene;hydrate |
|---|---|
| PubChem CID | 159915698 |
| Molecular Formula | C26H39F5O2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 1-(difluoromethoxy)-4-[4-[2,2-difluoro-2-(4-pentylcyclohexyl)ethyl]cyclohexyl]-2-fluorobenzene;hydrate |
| SMILES | CCCCCC1CCC(C(F)(F)CC2CCC(c3ccc(OC(F)F)c(F)c3)CC2)CC1.O |
| InChI | InChI=1S/C26H37F5O.H2O/c1-2-3-4-5-18-8-13-22(14-9-18)26(30,31)17-19-6-10-20(11-7-19)21-12-15-24(23(27)16-21)32-25(28)29;/h12,15-16,18-20,22,25H,2-11,13-14,17H2,1H3;1H2 |
| InChIKey | ITZXTMCBMWRYRA-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 40.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|