C31H33F5O2 — CID 22941265
1-(difluoromethoxy)-4-[2-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]phenyl]-2-fluorobenzene (PubChem CID 22941265) has the molecular formula C31H33F5O2 and a molecular weight of 532.59 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-[2-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]phenyl]-2-fluorobenzene.
| Compound Name | 1-(difluoromethoxy)-4-[2-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]phenyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 22941265 |
| Molecular Formula | C31H33F5O2 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 1-(difluoromethoxy)-4-[2-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]phenyl]-2-fluorobenzene |
| SMILES | CCCCCC1CCC(c2ccc(C(F)(F)Oc3ccccc3-c3ccc(OC(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C31H33F5O2/c1-2-3-4-7-21-10-12-22(13-11-21)23-14-17-25(18-15-23)31(35,36)38-28-9-6-5-8-26(28)24-16-19-29(27(32)20-24)37-30(33)34/h5-6,8-9,14-22,30H,2-4,7,10-13H2,1H3 |
| InChIKey | XYQGSEMAKCAYHO-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|